C19H30N2O3 — CID 59571671
tert-butyl N-[[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]piperidin-2-yl]methyl]carbamate (PubChem CID 59571671) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 59571671 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl N-[[(2S)-1-[(1R)-2-hydroxy-1-phenylethyl]piperidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCCCN1[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C19H30N2O3/c1-19(2,3)24-18(23)20-13-16-11-7-8-12-21(16)17(14-22)15-9-5-4-6-10-15/h4-6,9-10,16-17,22H,7-8,11-14H2,1-3H3,(H,20,23)/t16-,17-/m0/s1 |
| InChIKey | NDTWERSRRJLRET-IRXDYDNUSA-N |
| XLogP | 3.10 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |