C15H19NO2 — CID 11357004
(5S)-1-[(1S)-2-hydroxy-1-phenylethyl]-5-prop-2-enylpyrrolidin-2-one (PubChem CID 11357004) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (5S)-1-[(1S)-2-hydroxy-1-phenylethyl]-5-prop-2-enylpyrrolidin-2-one.
| Compound Name | (5S)-1-[(1S)-2-hydroxy-1-phenylethyl]-5-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11357004 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (5S)-1-[(1S)-2-hydroxy-1-phenylethyl]-5-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CC[C@@H]1CCC(=O)N1[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c1-2-6-13-9-10-15(18)16(13)14(11-17)12-7-4-3-5-8-12/h2-5,7-8,13-14,17H,1,6,9-11H2/t13-,14-/m1/s1 |
| InChIKey | HEBONCBHVCESRX-ZIAGYGMSSA-N |
| XLogP | 2.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|