C19H19NO2 — CID 102240792
(3S)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-prop-2-enyl-3H-isoindol-1-one (PubChem CID 102240792) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (3S)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-prop-2-enyl-3H-isoindol-1-one.
| Compound Name | (3S)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-prop-2-enyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 102240792 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3S)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-prop-2-enyl-3H-isoindol-1-one |
| SMILES | C=CC[C@H]1c2ccccc2C(=O)N1[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c1-2-8-17-15-11-6-7-12-16(15)19(22)20(17)18(13-21)14-9-4-3-5-10-14/h2-7,9-12,17-18,21H,1,8,13H2/t17-,18+/m0/s1 |
| InChIKey | SJOKRJIPSRRURV-ZWKOTPCHSA-N |
| XLogP | 3.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|