C22H19NO2 — CID 15422849
(3R)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-phenyl-3H-isoindol-1-one (PubChem CID 15422849) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3R)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-phenyl-3H-isoindol-1-one.
| Compound Name | (3R)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-phenyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 15422849 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (3R)-2-[(1S)-2-hydroxy-1-phenylethyl]-3-phenyl-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2[C@@H](c2ccccc2)N1[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C22H19NO2/c24-15-20(16-9-3-1-4-10-16)23-21(17-11-5-2-6-12-17)18-13-7-8-14-19(18)22(23)25/h1-14,20-21,24H,15H2/t20-,21-/m1/s1 |
| InChIKey | XOGFKXHVZINQLS-NHCUHLMSSA-N |
| XLogP | 3.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |