C32H41NO5 — CID 71625811
(2R)-2-[(2R,5S)-2,5-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-1-yl]-2-phenylethanol (PubChem CID 71625811) has the molecular formula C32H41NO5 and a molecular weight of 519.68 g/mol. Its IUPAC name is (2R)-2-[(2R,5S)-2,5-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-1-yl]-2-phenylethanol.
| Compound Name | (2R)-2-[(2R,5S)-2,5-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-1-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 71625811 |
| Molecular Formula | C32H41NO5 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | (2R)-2-[(2R,5S)-2,5-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-1-yl]-2-phenylethanol |
| SMILES | COc1ccc(CC[C@@H]2CC[C@H](CCc3ccc(OC)c(OC)c3)N2[C@@H](CO)c2ccccc2)cc1OC |
| InChI | InChI=1S/C32H41NO5/c1-35-29-18-12-23(20-31(29)37-3)10-14-26-16-17-27(33(26)28(22-34)25-8-6-5-7-9-25)15-11-24-13-19-30(36-2)32(21-24)38-4/h5-9,12-13,18-21,26-28,34H,10-11,14-17,22H2,1-4H3/t26-,27+,28-/m0/s1 |
| InChIKey | PMHOZMMFKXRNCG-IARZGTGTSA-N |
| XLogP | 5.85 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |