C20H25NO — CID 11254918
[(2R,3S)-3-benzyl-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methanol (PubChem CID 11254918) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is [(2R,3S)-3-benzyl-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R,3S)-3-benzyl-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 11254918 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | [(2R,3S)-3-benzyl-1-[(1R)-1-phenylethyl]pyrrolidin-2-yl]methanol |
| SMILES | C[C@H](c1ccccc1)N1CC[C@H](Cc2ccccc2)[C@@H]1CO |
| InChI | InChI=1S/C20H25NO/c1-16(18-10-6-3-7-11-18)21-13-12-19(20(21)15-22)14-17-8-4-2-5-9-17/h2-11,16,19-20,22H,12-15H2,1H3/t16-,19-,20+/m1/s1 |
| InChIKey | ZSWYIWIBTPRNDY-AHRSYUTCSA-N |
| XLogP | 3.67 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |