C34H34N2O2 — CID 11730822
(3S,6S)-3,6-dibenzyl-1,4-bis[(1S)-1-phenylethyl]piperazine-2,5-dione (PubChem CID 11730822) has the molecular formula C34H34N2O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is (3S,6S)-3,6-dibenzyl-1,4-bis[(1S)-1-phenylethyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-dibenzyl-1,4-bis[(1S)-1-phenylethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 11730822 |
| Molecular Formula | C34H34N2O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (3S,6S)-3,6-dibenzyl-1,4-bis[(1S)-1-phenylethyl]piperazine-2,5-dione |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)[C@H](Cc2ccccc2)N([C@@H](C)c2ccccc2)C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C34H34N2O2/c1-25(29-19-11-5-12-20-29)35-31(23-27-15-7-3-8-16-27)34(38)36(26(2)30-21-13-6-14-22-30)32(33(35)37)24-28-17-9-4-10-18-28/h3-22,25-26,31-32H,23-24H2,1-2H3/t25-,26-,31-,32-/m0/s1 |
| InChIKey | LKMOHPNJWORYFJ-MCZNPFQCSA-N |
| XLogP | 6.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |