C22H25N — CID 10470251
(2S)-2-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-2H-pyridine (PubChem CID 10470251) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is (2S)-2-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-2H-pyridine.
| Compound Name | (2S)-2-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-2H-pyridine |
|---|---|
| PubChem CID | 10470251 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (2S)-2-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-2H-pyridine |
| SMILES | CC1=C(C)[C@H](Cc2ccccc2)N([C@H](C)c2ccccc2)C=C1 |
| InChI | InChI=1S/C22H25N/c1-17-14-15-23(19(3)21-12-8-5-9-13-21)22(18(17)2)16-20-10-6-4-7-11-20/h4-15,19,22H,16H2,1-3H3/t19-,22+/m1/s1 |
| InChIKey | VYBLOMCLOBQTIV-KNQAVFIVSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |