C19H23ClN2 — CID 173292599
1,3-bis[(1S)-1-phenylethyl]-2H-imidazole;hydrochloride (PubChem CID 173292599) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 1,3-bis[(1S)-1-phenylethyl]-2H-imidazole;hydrochloride.
| Compound Name | 1,3-bis[(1S)-1-phenylethyl]-2H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 173292599 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1,3-bis[(1S)-1-phenylethyl]-2H-imidazole;hydrochloride |
| SMILES | C[C@@H](c1ccccc1)N1C=CN([C@@H](C)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C19H22N2.ClH/c1-16(18-9-5-3-6-10-18)20-13-14-21(15-20)17(2)19-11-7-4-8-12-19;/h3-14,16-17H,15H2,1-2H3;1H/t16-,17-;/m0./s1 |
| InChIKey | HUZKVSNKWHUMOW-QJHJCNPRSA-N |
| XLogP | 4.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |