C16H19NO2 — CID 57202782
2-(1-phenylethyl)-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 57202782) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-(1-phenylethyl)-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-(1-phenylethyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 57202782 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-(1-phenylethyl)-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | CC(c1ccccc1)n1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C16H19NO2/c1-11(12-7-3-2-4-8-12)17-15(18)13-9-5-6-10-14(13)16(17)19/h2-4,7-8,11,18-19H,5-6,9-10H2,1H3 |
| InChIKey | JAEMGFKKFNBALI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |