C16H15NO3 — CID 91435064
(4S,7R)-2-[(1S)-1-phenylethyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol (PubChem CID 91435064) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (4S,7R)-2-[(1S)-1-phenylethyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol.
| Compound Name | (4S,7R)-2-[(1S)-1-phenylethyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 91435064 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (4S,7R)-2-[(1S)-1-phenylethyl]-4,7-dihydro-4,7-epoxyisoindole-1,3-diol |
| SMILES | C[C@@H](c1ccccc1)n1c(O)c2c(c1O)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C16H15NO3/c1-9(10-5-3-2-4-6-10)17-15(18)13-11-7-8-12(20-11)14(13)16(17)19/h2-9,11-12,18-19H,1H3/t9-,11-,12+/m0/s1 |
| InChIKey | KSKLKMRTXWYIOS-ZMLRMANQSA-N |
| XLogP | 3.19 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|