C26H20N2O4 — CID 1226046
2,6-bis[(1S)-1-phenylethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 1226046) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2,6-bis[(1S)-1-phenylethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[(1S)-1-phenylethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 1226046 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2,6-bis[(1S)-1-phenylethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | C[C@@H](c1ccccc1)n1c(=O)c2cc3c(=O)n([C@@H](C)c4ccccc4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C26H20N2O4/c1-15(17-9-5-3-6-10-17)27-23(29)19-13-21-22(14-20(19)24(27)30)26(32)28(25(21)31)16(2)18-11-7-4-8-12-18/h3-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | QAQORBCMWZMXQY-HOTGVXAUSA-N |
| XLogP | 3.13 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |