C18H18N2O3S — CID 4889991
6,7-dimethoxy-3-(1-phenylethyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4889991) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 6,7-dimethoxy-3-(1-phenylethyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-3-(1-phenylethyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4889991 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 6,7-dimethoxy-3-(1-phenylethyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1cc2[nH]c(=S)n(C(C)c3ccccc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C18H18N2O3S/c1-11(12-7-5-4-6-8-12)20-17(21)13-9-15(22-2)16(23-3)10-14(13)19-18(20)24/h4-11H,1-3H3,(H,19,24) |
| InChIKey | CJZGGANMCJFTOT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|