C12H19ClN2 — CID 22856183
[(2S)-1-benzylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 22856183) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is [(2S)-1-benzylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [(2S)-1-benzylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 22856183 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [(2S)-1-benzylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NC[C@@H]1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C12H18N2.ClH/c13-9-12-7-4-8-14(12)10-11-5-2-1-3-6-11;/h1-3,5-6,12H,4,7-10,13H2;1H/t12-;/m0./s1 |
| InChIKey | TWGKQRSPEZZYRK-YDALLXLXSA-N |
| XLogP | 2.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |