C12H17FN2 — CID 14709038
[(2R)-1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine (PubChem CID 14709038) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is [(2R)-1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine.
| Compound Name | [(2R)-1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 14709038 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | [(2R)-1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methanamine |
| SMILES | NC[C@H]1CCCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2/c13-11-5-3-10(4-6-11)9-15-7-1-2-12(15)8-14/h3-6,12H,1-2,7-9,14H2/t12-/m1/s1 |
| InChIKey | BOKXGTOMUFSZQX-GFCCVEGCSA-N |
| XLogP | 1.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |