C13H20ClFN2 — CID 119916113
[1-[(4-fluorophenyl)methyl]piperidin-2-yl]methanamine;hydrochloride (PubChem CID 119916113) has the molecular formula C13H20ClFN2 and a molecular weight of 258.77 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]piperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-[(4-fluorophenyl)methyl]piperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119916113 |
| Molecular Formula | C13H20ClFN2 |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]piperidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FN2.ClH/c14-12-6-4-11(5-7-12)10-16-8-2-1-3-13(16)9-15;/h4-7,13H,1-3,8-10,15H2;1H |
| InChIKey | LYCBQUXESRSRIN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |