C21H25O2P — CID 102488052
1-[4-[benzyl(cyclohexyl)phosphoryl]phenyl]ethanone (PubChem CID 102488052) has the molecular formula C21H25O2P and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-[4-[benzyl(cyclohexyl)phosphoryl]phenyl]ethanone.
| Compound Name | 1-[4-[benzyl(cyclohexyl)phosphoryl]phenyl]ethanone |
|---|---|
| PubChem CID | 102488052 |
| Molecular Formula | C21H25O2P |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[4-[benzyl(cyclohexyl)phosphoryl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(P(=O)(Cc2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25O2P/c1-17(22)19-12-14-21(15-13-19)24(23,20-10-6-3-7-11-20)16-18-8-4-2-5-9-18/h2,4-5,8-9,12-15,20H,3,6-7,10-11,16H2,1H3 |
| InChIKey | STHOXBLSCBETFE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|