C16H25OP — CID 66796119
[butyl(cyclohexyl)phosphoryl]benzene (PubChem CID 66796119) has the molecular formula C16H25OP and a molecular weight of 264.35 g/mol. Its IUPAC name is [butyl(cyclohexyl)phosphoryl]benzene.
| Compound Name | [butyl(cyclohexyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 66796119 |
| Molecular Formula | C16H25OP |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [butyl(cyclohexyl)phosphoryl]benzene |
| SMILES | CCCCP(=O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H25OP/c1-2-3-14-18(17,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4,6-7,10-11,16H,2-3,5,8-9,12-14H2,1H3 |
| InChIKey | MDVKYQZSIJFNRE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|