C16H25O4PS — CID 603389
3-[cyclohexyl(phenyl)phosphoryl]propyl methanesulfonate (PubChem CID 603389) has the molecular formula C16H25O4PS and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[cyclohexyl(phenyl)phosphoryl]propyl methanesulfonate.
| Compound Name | 3-[cyclohexyl(phenyl)phosphoryl]propyl methanesulfonate |
|---|---|
| PubChem CID | 603389 |
| Molecular Formula | C16H25O4PS |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-[cyclohexyl(phenyl)phosphoryl]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCP(=O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H25O4PS/c1-22(18,19)20-13-8-14-21(17,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2,4-5,9-10,16H,3,6-8,11-14H2,1H3 |
| InChIKey | MADUCFGJVDHJBN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|