C18H24O5S — CID 10689342
[(1R,2S)-2-phenylcyclohexyl] (E)-5-methylsulfonyloxypent-2-enoate (PubChem CID 10689342) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl] (E)-5-methylsulfonyloxypent-2-enoate.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl] (E)-5-methylsulfonyloxypent-2-enoate |
|---|---|
| PubChem CID | 10689342 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl] (E)-5-methylsulfonyloxypent-2-enoate |
| SMILES | CS(=O)(=O)OCC/C=C/C(=O)O[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H24O5S/c1-24(20,21)22-14-8-7-13-18(19)23-17-12-6-5-11-16(17)15-9-3-2-4-10-15/h2-4,7,9-10,13,16-17H,5-6,8,11-12,14H2,1H3/b13-7+/t16-,17+/m0/s1 |
| InChIKey | IAWRUNWNSYZDAJ-RVDBLKIQSA-N |
| XLogP | 3.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|