C34H36O4Se — CID 11028311
bis[(1R,2S)-2-phenylcyclohexyl] (Z)-2-phenylselanylbut-2-enedioate (PubChem CID 11028311) has the molecular formula C34H36O4Se and a molecular weight of 587.62 g/mol. Its IUPAC name is bis[(1R,2S)-2-phenylcyclohexyl] (Z)-2-phenylselanylbut-2-enedioate.
| Compound Name | bis[(1R,2S)-2-phenylcyclohexyl] (Z)-2-phenylselanylbut-2-enedioate |
|---|---|
| PubChem CID | 11028311 |
| Molecular Formula | C34H36O4Se |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | bis[(1R,2S)-2-phenylcyclohexyl] (Z)-2-phenylselanylbut-2-enedioate |
| SMILES | O=C(/C=C(\[Se]c1ccccc1)C(=O)O[C@@H]1CCCC[C@H]1c1ccccc1)O[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C34H36O4Se/c35-33(37-30-22-12-10-20-28(30)25-14-4-1-5-15-25)24-32(39-27-18-8-3-9-19-27)34(36)38-31-23-13-11-21-29(31)26-16-6-2-7-17-26/h1-9,14-19,24,28-31H,10-13,20-23H2/b32-24-/t28-,29-,30+,31+/m0/s1 |
| InChIKey | RNNFBBPEKMLLKK-TXWXDHCGSA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|