C18H21O2P — CID 174639588
[cyclohexyl(phenyl)phosphoryl]oxybenzene (PubChem CID 174639588) has the molecular formula C18H21O2P and a molecular weight of 300.34 g/mol. Its IUPAC name is [cyclohexyl(phenyl)phosphoryl]oxybenzene.
| Compound Name | [cyclohexyl(phenyl)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 174639588 |
| Molecular Formula | C18H21O2P |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [cyclohexyl(phenyl)phosphoryl]oxybenzene |
| SMILES | O=P(Oc1ccccc1)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H21O2P/c19-21(17-12-6-2-7-13-17,18-14-8-3-9-15-18)20-16-10-4-1-5-11-16/h1-2,4-7,10-13,18H,3,8-9,14-15H2 |
| InChIKey | GKKFWSVDLBGPKG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|