C30H30O8P2 — CID 98141630
[(1R,2S)-2-diphenoxyphosphoryloxycyclohexyl] diphenyl phosphate (PubChem CID 98141630) has the molecular formula C30H30O8P2 and a molecular weight of 580.51 g/mol. Its IUPAC name is [(1R,2S)-2-diphenoxyphosphoryloxycyclohexyl] diphenyl phosphate.
| Compound Name | [(1R,2S)-2-diphenoxyphosphoryloxycyclohexyl] diphenyl phosphate |
|---|---|
| PubChem CID | 98141630 |
| Molecular Formula | C30H30O8P2 |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | [(1R,2S)-2-diphenoxyphosphoryloxycyclohexyl] diphenyl phosphate |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)O[C@H]1CCCC[C@H]1OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C30H30O8P2/c31-39(33-25-15-5-1-6-16-25,34-26-17-7-2-8-18-26)37-29-23-13-14-24-30(29)38-40(32,35-27-19-9-3-10-20-27)36-28-21-11-4-12-22-28/h1-12,15-22,29-30H,13-14,23-24H2/t29-,30+ |
| InChIKey | YVYCPYNXICLAGD-RNPORBBMSA-N |
| XLogP | 8.86 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|