C14H21OPS2 — CID 165353283
cyclohexyl-ethylsulfanyl-phenoxy-sulfanylidene-λ5-phosphane (PubChem CID 165353283) has the molecular formula C14H21OPS2 and a molecular weight of 300.43 g/mol. Its IUPAC name is cyclohexyl-ethylsulfanyl-phenoxy-sulfanylidene-λ5-phosphane.
| Compound Name | cyclohexyl-ethylsulfanyl-phenoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 165353283 |
| Molecular Formula | C14H21OPS2 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | cyclohexyl-ethylsulfanyl-phenoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCSP(=S)(Oc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C14H21OPS2/c1-2-18-16(17,14-11-7-4-8-12-14)15-13-9-5-3-6-10-13/h3,5-6,9-10,14H,2,4,7-8,11-12H2,1H3 |
| InChIKey | FRIJIUAGZXLCBR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|