C20H24NO3PS2 — CID 12878832
2-diphenoxyphosphinothioylsulfanyl-1-(2-methylpiperidin-1-yl)ethanone (PubChem CID 12878832) has the molecular formula C20H24NO3PS2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-diphenoxyphosphinothioylsulfanyl-1-(2-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-diphenoxyphosphinothioylsulfanyl-1-(2-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 12878832 |
| Molecular Formula | C20H24NO3PS2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-diphenoxyphosphinothioylsulfanyl-1-(2-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCCN1C(=O)CSP(=S)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C20H24NO3PS2/c1-17-10-8-9-15-21(17)20(22)16-27-25(26,23-18-11-4-2-5-12-18)24-19-13-6-3-7-14-19/h2-7,11-14,17H,8-10,15-16H2,1H3 |
| InChIKey | WVJVIWNQGDJXDQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|