C25H38O4 — CID 102532493
(2S,3S,6S,8S,9S,10S)-3,9-dimethyl-2-[(2R)-2-phenylmethoxybutyl]-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol (PubChem CID 102532493) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (2S,3S,6S,8S,9S,10S)-3,9-dimethyl-2-[(2R)-2-phenylmethoxybutyl]-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol.
| Compound Name | (2S,3S,6S,8S,9S,10S)-3,9-dimethyl-2-[(2R)-2-phenylmethoxybutyl]-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 102532493 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (2S,3S,6S,8S,9S,10S)-3,9-dimethyl-2-[(2R)-2-phenylmethoxybutyl]-8-prop-2-enyl-1,7-dioxaspiro[5.5]undecan-10-ol |
| SMILES | C=CC[C@@H]1O[C@@]2(CC[C@H](C)[C@H](C[C@@H](CC)OCc3ccccc3)O2)C[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C25H38O4/c1-5-10-23-19(4)22(26)16-25(28-23)14-13-18(3)24(29-25)15-21(6-2)27-17-20-11-8-7-9-12-20/h5,7-9,11-12,18-19,21-24,26H,1,6,10,13-17H2,2-4H3/t18-,19-,21+,22-,23-,24-,25+/m0/s1 |
| InChIKey | BRNDOQUCAWMHRM-JLYOJAPGSA-N |
| XLogP | 5.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|