C35H48O6S2 — CID 25228779
[(2S,3S,6R,8S,9R,10S)-8-(1,3-dithian-2-ylmethyl)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate (PubChem CID 25228779) has the molecular formula C35H48O6S2 and a molecular weight of 628.90 g/mol. Its IUPAC name is [(2S,3S,6R,8S,9R,10S)-8-(1,3-dithian-2-ylmethyl)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate.
| Compound Name | [(2S,3S,6R,8S,9R,10S)-8-(1,3-dithian-2-ylmethyl)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate |
|---|---|
| PubChem CID | 25228779 |
| Molecular Formula | C35H48O6S2 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | [(2S,3S,6R,8S,9R,10S)-8-(1,3-dithian-2-ylmethyl)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate |
| SMILES | CC[C@H](C[C@@H]1O[C@@]2(CC[C@@H]1C)C[C@H](OC(=O)c1ccccc1)[C@H](C)[C@H](CC1SCCCS1)O2)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C35H48O6S2/c1-5-28(38-23-26-12-14-29(37-4)15-13-26)20-30-24(2)16-17-35(40-30)22-32(39-34(36)27-10-7-6-8-11-27)25(3)31(41-35)21-33-42-18-9-19-43-33/h6-8,10-15,24-25,28,30-33H,5,9,16-23H2,1-4H3/t24-,25+,28+,30-,31-,32-,35+/m0/s1 |
| InChIKey | DGOLIIRJGAPZPP-PPIKEFETSA-N |
| XLogP | 8.13 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |