C26H34O5 — CID 11339322
(1R,3R,4S,7S)-4-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-1,3,7-trimethyl-1,3,4,7-tetrahydro-2,6-benzodioxonin-5-one (PubChem CID 11339322) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is (1R,3R,4S,7S)-4-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-1,3,7-trimethyl-1,3,4,7-tetrahydro-2,6-benzodioxonin-5-one.
| Compound Name | (1R,3R,4S,7S)-4-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-1,3,7-trimethyl-1,3,4,7-tetrahydro-2,6-benzodioxonin-5-one |
|---|---|
| PubChem CID | 11339322 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (1R,3R,4S,7S)-4-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-1,3,7-trimethyl-1,3,4,7-tetrahydro-2,6-benzodioxonin-5-one |
| SMILES | CC[C@H](C[C@@H]1C(=O)O[C@@H](C)c2ccccc2[C@@H](C)O[C@@H]1C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34O5/c1-6-21(29-16-20-11-13-22(28-5)14-12-20)15-25-19(4)30-17(2)23-9-7-8-10-24(23)18(3)31-26(25)27/h7-14,17-19,21,25H,6,15-16H2,1-5H3/t17-,18+,19-,21-,25+/m1/s1 |
| InChIKey | IUOFYVXPDVVQRY-YWIBANCPSA-N |
| XLogP | 5.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |