C12H18O3 — CID 146450943
2-[(4-methoxyphenyl)methoxy]butan-1-ol (PubChem CID 146450943) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxy]butan-1-ol.
| Compound Name | 2-[(4-methoxyphenyl)methoxy]butan-1-ol |
|---|---|
| PubChem CID | 146450943 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]butan-1-ol |
| SMILES | CCC(CO)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C12H18O3/c1-3-11(8-13)15-9-10-4-6-12(14-2)7-5-10/h4-7,11,13H,3,8-9H2,1-2H3 |
| InChIKey | UQIDPHFAAOPLBG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |