C25H32O4S2 — CID 170714437
2-[(4-methoxyphenyl)methoxy]propane-1,3-diol;bis(4-methylbenzenethiol) (PubChem CID 170714437) has the molecular formula C25H32O4S2 and a molecular weight of 460.66 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxy]propane-1,3-diol;bis(4-methylbenzenethiol).
| Compound Name | 2-[(4-methoxyphenyl)methoxy]propane-1,3-diol;bis(4-methylbenzenethiol) |
|---|---|
| PubChem CID | 170714437 |
| Molecular Formula | C25H32O4S2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]propane-1,3-diol;bis(4-methylbenzenethiol) |
| SMILES | COc1ccc(COC(CO)CO)cc1.Cc1ccc(S)cc1.Cc1ccc(S)cc1 |
| InChI | InChI=1S/C11H16O4.2C7H8S/c1-14-10-4-2-9(3-5-10)8-15-11(6-12)7-13;2*1-6-2-4-7(8)5-3-6/h2-5,11-13H,6-8H2,1H3;2*2-5,8H,1H3 |
| InChIKey | PDDSVNLOAIIZBG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|