C32H42O5 — CID 11283536
(2S,4aR,6S,11S,13aR)-2-[(4-methoxyphenyl)methoxy]-3-methyl-6,11-bis(2-methylpropyl)-1,2,4a,6,11,13a-hexahydrobenzo[c][2,6]benzodioxonin-13-one (PubChem CID 11283536) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is (2S,4aR,6S,11S,13aR)-2-[(4-methoxyphenyl)methoxy]-3-methyl-6,11-bis(2-methylpropyl)-1,2,4a,6,11,13a-hexahydrobenzo[c][2,6]benzodioxonin-13-one.
| Compound Name | (2S,4aR,6S,11S,13aR)-2-[(4-methoxyphenyl)methoxy]-3-methyl-6,11-bis(2-methylpropyl)-1,2,4a,6,11,13a-hexahydrobenzo[c][2,6]benzodioxonin-13-one |
|---|---|
| PubChem CID | 11283536 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | (2S,4aR,6S,11S,13aR)-2-[(4-methoxyphenyl)methoxy]-3-methyl-6,11-bis(2-methylpropyl)-1,2,4a,6,11,13a-hexahydrobenzo[c][2,6]benzodioxonin-13-one |
| SMILES | COc1ccc(CO[C@H]2C[C@H]3C(=O)O[C@@H](CC(C)C)c4ccccc4[C@H](CC(C)C)O[C@@H]3C=C2C)cc1 |
| InChI | InChI=1S/C32H42O5/c1-20(2)15-29-25-9-7-8-10-26(25)30(16-21(3)4)37-32(33)27-18-28(22(5)17-31(27)36-29)35-19-23-11-13-24(34-6)14-12-23/h7-14,17,20-21,27-31H,15-16,18-19H2,1-6H3/t27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | LOOHWXSMWYVNEC-MOUVJORGSA-N |
| XLogP | 7.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|