C28H36O5 — CID 24796955
(2S,3R,5Z,7R,8S)-3-[(4-methoxyphenyl)methoxy]-5,7-dimethyl-8-[(2R)-1-phenylmethoxypropan-2-yl]-3,4,7,8-tetrahydro-2H-oxocine-2-carbaldehyde (PubChem CID 24796955) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is (2S,3R,5Z,7R,8S)-3-[(4-methoxyphenyl)methoxy]-5,7-dimethyl-8-[(2R)-1-phenylmethoxypropan-2-yl]-3,4,7,8-tetrahydro-2H-oxocine-2-carbaldehyde.
| Compound Name | (2S,3R,5Z,7R,8S)-3-[(4-methoxyphenyl)methoxy]-5,7-dimethyl-8-[(2R)-1-phenylmethoxypropan-2-yl]-3,4,7,8-tetrahydro-2H-oxocine-2-carbaldehyde |
|---|---|
| PubChem CID | 24796955 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2S,3R,5Z,7R,8S)-3-[(4-methoxyphenyl)methoxy]-5,7-dimethyl-8-[(2R)-1-phenylmethoxypropan-2-yl]-3,4,7,8-tetrahydro-2H-oxocine-2-carbaldehyde |
| SMILES | COc1ccc(CO[C@@H]2C/C(C)=C\[C@@H](C)[C@@H]([C@H](C)COCc3ccccc3)O[C@@H]2C=O)cc1 |
| InChI | InChI=1S/C28H36O5/c1-20-14-21(2)28(22(3)17-31-18-23-8-6-5-7-9-23)33-27(16-29)26(15-20)32-19-24-10-12-25(30-4)13-11-24/h5-14,16,21-22,26-28H,15,17-19H2,1-4H3/b20-14-/t21-,22-,26-,27-,28+/m1/s1 |
| InChIKey | XNNPKMQVXFNTLE-CNOSTBOUSA-N |
| XLogP | 5.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|