C17H24O3 — CID 11572647
(2R,3S)-6-methoxy-3-methyl-2-[(2S)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran (PubChem CID 11572647) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2R,3S)-6-methoxy-3-methyl-2-[(2S)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S)-6-methoxy-3-methyl-2-[(2S)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11572647 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2R,3S)-6-methoxy-3-methyl-2-[(2S)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran |
| SMILES | COC1C=C[C@H](C)[C@H]([C@@H](C)COCc2ccccc2)O1 |
| InChI | InChI=1S/C17H24O3/c1-13-9-10-16(18-3)20-17(13)14(2)11-19-12-15-7-5-4-6-8-15/h4-10,13-14,16-17H,11-12H2,1-3H3/t13-,14-,16?,17+/m0/s1 |
| InChIKey | DKZDKUTWGVFGEY-VZEYSKEKSA-N |
| XLogP | 3.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|