C18H24O4 — CID 10733309
methyl (2S,3R,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 10733309) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl (2S,3R,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | methyl (2S,3R,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 10733309 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl (2S,3R,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@H]([C@H](C)COCc2ccccc2)C=C[C@H]1C |
| InChI | InChI=1S/C18H24O4/c1-13-9-10-16(22-17(13)18(19)20-3)14(2)11-21-12-15-7-5-4-6-8-15/h4-10,13-14,16-17H,11-12H2,1-3H3/t13-,14-,16+,17+/m1/s1 |
| InChIKey | OPUCITXUZZKAOI-JHNDHUHGSA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|