C27H44O6 — CID 15965826
(2S,3S,6R)-2-[(2S,5S,6S)-5-(1-ethoxyethoxy)-7-[(4-methoxyphenyl)methoxy]-6-methylheptan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran (PubChem CID 15965826) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is (2S,3S,6R)-2-[(2S,5S,6S)-5-(1-ethoxyethoxy)-7-[(4-methoxyphenyl)methoxy]-6-methylheptan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,3S,6R)-2-[(2S,5S,6S)-5-(1-ethoxyethoxy)-7-[(4-methoxyphenyl)methoxy]-6-methylheptan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 15965826 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (2S,3S,6R)-2-[(2S,5S,6S)-5-(1-ethoxyethoxy)-7-[(4-methoxyphenyl)methoxy]-6-methylheptan-2-yl]-6-methoxy-3-methyl-3,6-dihydro-2H-pyran |
| SMILES | CCOC(C)O[C@@H](CC[C@H](C)[C@@H]1O[C@@H](OC)C=C[C@@H]1C)[C@@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H44O6/c1-8-31-22(5)32-25(15-9-19(2)27-20(3)10-16-26(29-7)33-27)21(4)17-30-18-23-11-13-24(28-6)14-12-23/h10-14,16,19-22,25-27H,8-9,15,17-18H2,1-7H3/t19-,20-,21-,22?,25-,26+,27-/m0/s1 |
| InChIKey | DCNDNTUPBYHBOQ-PKMWZQHXSA-N |
| XLogP | 5.60 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|