C19H28O4 — CID 134942819
1-[[(2S,3S)-3-(2-ethoxyethoxy)-2-methylhex-5-ynoxy]methyl]-4-methoxybenzene (PubChem CID 134942819) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-[[(2S,3S)-3-(2-ethoxyethoxy)-2-methylhex-5-ynoxy]methyl]-4-methoxybenzene.
| Compound Name | 1-[[(2S,3S)-3-(2-ethoxyethoxy)-2-methylhex-5-ynoxy]methyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 134942819 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-[[(2S,3S)-3-(2-ethoxyethoxy)-2-methylhex-5-ynoxy]methyl]-4-methoxybenzene |
| SMILES | C#CC[C@H](OCCOCC)[C@@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H28O4/c1-5-7-19(23-13-12-21-6-2)16(3)14-22-15-17-8-10-18(20-4)11-9-17/h1,8-11,16,19H,6-7,12-15H2,2-4H3/t16-,19-/m0/s1 |
| InChIKey | YSRJFJLDXKASOX-LPHOPBHVSA-N |
| XLogP | 3.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|