C16H24O3 — CID 10084181
(E,2R,5S)-1-[(4-methoxyphenyl)methoxy]-5-methylhept-3-en-2-ol (PubChem CID 10084181) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (E,2R,5S)-1-[(4-methoxyphenyl)methoxy]-5-methylhept-3-en-2-ol.
| Compound Name | (E,2R,5S)-1-[(4-methoxyphenyl)methoxy]-5-methylhept-3-en-2-ol |
|---|---|
| PubChem CID | 10084181 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (E,2R,5S)-1-[(4-methoxyphenyl)methoxy]-5-methylhept-3-en-2-ol |
| SMILES | CC[C@H](C)/C=C/[C@@H](O)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H24O3/c1-4-13(2)5-8-15(17)12-19-11-14-6-9-16(18-3)10-7-14/h5-10,13,15,17H,4,11-12H2,1-3H3/b8-5+/t13-,15+/m0/s1 |
| InChIKey | AAGHWGTWHRSJBH-FFAUQURTSA-N |
| XLogP | 3.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|