C15H20O2 — CID 91404007
1-methoxy-4-[[(2S)-2-methylhexa-3,5-dienoxy]methyl]benzene (PubChem CID 91404007) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-methoxy-4-[[(2S)-2-methylhexa-3,5-dienoxy]methyl]benzene.
| Compound Name | 1-methoxy-4-[[(2S)-2-methylhexa-3,5-dienoxy]methyl]benzene |
|---|---|
| PubChem CID | 91404007 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1-methoxy-4-[[(2S)-2-methylhexa-3,5-dienoxy]methyl]benzene |
| SMILES | C=CC=C[C@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H20O2/c1-4-5-6-13(2)11-17-12-14-7-9-15(16-3)10-8-14/h4-10,13H,1,11-12H2,2-3H3/t13-/m0/s1 |
| InChIKey | IGHQXZDOGYJBFJ-ZDUSSCGKSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|