C31H44O6 — CID 10874918
(4S,5S)-4-[(Z,2S,5S)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-3-en-2-yl]-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10874918) has the molecular formula C31H44O6 and a molecular weight of 512.69 g/mol. Its IUPAC name is (4S,5S)-4-[(Z,2S,5S)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-3-en-2-yl]-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-[(Z,2S,5S)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-3-en-2-yl]-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10874918 |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | (4S,5S)-4-[(Z,2S,5S)-6-[(4-methoxyphenyl)methoxy]-5-methylhex-3-en-2-yl]-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | COc1ccc(COC[C@@H](C)/C=C\[C@H](C)[C@@H]2OC(C)(C)O[C@H]2[C@@H](C)COCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H44O6/c1-22(18-34-20-25-10-14-27(32-6)15-11-25)8-9-23(2)29-30(37-31(4,5)36-29)24(3)19-35-21-26-12-16-28(33-7)17-13-26/h8-17,22-24,29-30H,18-21H2,1-7H3/b9-8-/t22-,23-,24-,29-,30-/m0/s1 |
| InChIKey | LZQTZSOFIKALQS-QJCTVIICSA-N |
| XLogP | 6.42 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|