C25H38O7 — CID 102350335
ethyl (E,2R,5R)-5-hydroxy-5-[(4R,5R)-5-[(2R)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpent-3-enoate (PubChem CID 102350335) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is ethyl (E,2R,5R)-5-hydroxy-5-[(4R,5R)-5-[(2R)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpent-3-enoate.
| Compound Name | ethyl (E,2R,5R)-5-hydroxy-5-[(4R,5R)-5-[(2R)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 102350335 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | ethyl (E,2R,5R)-5-hydroxy-5-[(4R,5R)-5-[(2R)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpent-3-enoate |
| SMILES | CCOC(=O)[C@H](C)/C=C(\C)[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H38O7/c1-8-30-24(27)17(3)13-16(2)21(26)23-22(31-25(5,6)32-23)18(4)14-29-15-19-9-11-20(28-7)12-10-19/h9-13,17-18,21-23,26H,8,14-15H2,1-7H3/b16-13+/t17-,18-,21-,22-,23-/m1/s1 |
| InChIKey | FHRHBBZXHXNWAQ-SLWKSRJPSA-N |
| XLogP | 3.87 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|