C37H64O6Si — CID 146163003
(2E,5S,6Z)-1-[(4S,5S)-5-[(3S)-4-[(4-methoxyphenyl)methoxy]-3-methylbutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-5-tri(propan-2-yl)silyloxyocta-2,6-dien-1-ol (PubChem CID 146163003) has the molecular formula C37H64O6Si and a molecular weight of 633.00 g/mol. Its IUPAC name is (2E,5S,6Z)-1-[(4S,5S)-5-[(3S)-4-[(4-methoxyphenyl)methoxy]-3-methylbutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-5-tri(propan-2-yl)silyloxyocta-2,6-dien-1-ol.
| Compound Name | (2E,5S,6Z)-1-[(4S,5S)-5-[(3S)-4-[(4-methoxyphenyl)methoxy]-3-methylbutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-5-tri(propan-2-yl)silyloxyocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 146163003 |
| Molecular Formula | C37H64O6Si |
| Molecular Weight | 633.00 g/mol |
| Exact Mass | 632.45 |
| IUPAC Name | (2E,5S,6Z)-1-[(4S,5S)-5-[(3S)-4-[(4-methoxyphenyl)methoxy]-3-methylbutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,6-dimethyl-5-tri(propan-2-yl)silyloxyocta-2,6-dien-1-ol |
| SMILES | C/C=C(/C)[C@H](C/C=C(\C)C(O)[C@@H]1OC(C)(C)O[C@H]1CC[C@H](C)COCc1ccc(OC)cc1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H64O6Si/c1-14-29(9)33(43-44(25(2)3,26(4)5)27(6)7)22-16-30(10)35(38)36-34(41-37(11,12)42-36)21-15-28(8)23-40-24-31-17-19-32(39-13)20-18-31/h14,16-20,25-28,33-36,38H,15,21-24H2,1-13H3/b29-14-,30-16+/t28-,33-,34-,35?,36+/m0/s1 |
| InChIKey | IJRBYMKBGUQFAY-WXXIRIEOSA-N |
| XLogP | 9.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.00 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|