C22H33IO4 — CID 59482105
(4R,5R)-4-(2-iodoethyl)-5-[(Z,6R)-6-[(4-methoxyphenyl)methoxy]hept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 59482105) has the molecular formula C22H33IO4 and a molecular weight of 488.41 g/mol. Its IUPAC name is (4R,5R)-4-(2-iodoethyl)-5-[(Z,6R)-6-[(4-methoxyphenyl)methoxy]hept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-(2-iodoethyl)-5-[(Z,6R)-6-[(4-methoxyphenyl)methoxy]hept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 59482105 |
| Molecular Formula | C22H33IO4 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (4R,5R)-4-(2-iodoethyl)-5-[(Z,6R)-6-[(4-methoxyphenyl)methoxy]hept-3-en-2-yl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | COc1ccc(CO[C@H](C)C/C=C\C(C)[C@H]2OC(C)(C)O[C@@H]2CCI)cc1 |
| InChI | InChI=1S/C22H33IO4/c1-16(21-20(13-14-23)26-22(3,4)27-21)7-6-8-17(2)25-15-18-9-11-19(24-5)12-10-18/h6-7,9-12,16-17,20-21H,8,13-15H2,1-5H3/b7-6-/t16?,17-,20-,21-/m1/s1 |
| InChIKey | DNNAFKJVOGYVOX-RKXOTBPGSA-N |
| XLogP | 5.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|