C37H49IO5Si — CID 91592610
tert-butyl-[(2R)-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-4-en-2-yl]oxy-diphenylsilane (PubChem CID 91592610) has the molecular formula C37H49IO5Si and a molecular weight of 728.78 g/mol. Its IUPAC name is tert-butyl-[(2R)-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-4-en-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R)-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-4-en-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 91592610 |
| Molecular Formula | C37H49IO5Si |
| Molecular Weight | 728.78 g/mol |
| Exact Mass | 728.24 |
| IUPAC Name | tert-butyl-[(2R)-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-4-en-2-yl]oxy-diphenylsilane |
| SMILES | COc1ccc(COC(C=CC[C@@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2CCI)cc1 |
| InChI | InChI=1S/C37H49IO5Si/c1-28(43-44(36(2,3)4,31-16-10-8-11-17-31)32-18-12-9-13-19-32)15-14-20-33(35-34(25-26-38)41-37(5,6)42-35)40-27-29-21-23-30(39-7)24-22-29/h8-14,16-24,28,33-35H,15,25-27H2,1-7H3/t28-,33?,34+,35-/m1/s1 |
| InChIKey | ZPLHOSPGSVTLAX-ZKXKEKPISA-N |
| XLogP | 7.84 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.78 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|