C21H29IO4 — CID 58304829
[(Z)-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate (PubChem CID 58304829) has the molecular formula C21H29IO4 and a molecular weight of 472.36 g/mol. Its IUPAC name is [(Z)-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate.
| Compound Name | [(Z)-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate |
|---|---|
| PubChem CID | 58304829 |
| Molecular Formula | C21H29IO4 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | [(Z)-1-[(5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-methylhex-2-enyl] benzoate |
| SMILES | CC(C)C/C=C\C(OC(=O)c1ccccc1)C1OC(C)(C)O[C@H]1CCI |
| InChI | InChI=1S/C21H29IO4/c1-15(2)9-8-12-17(24-20(23)16-10-6-5-7-11-16)19-18(13-14-22)25-21(3,4)26-19/h5-8,10-12,15,17-19H,9,13-14H2,1-4H3/b12-8-/t17?,18-,19?/m0/s1 |
| InChIKey | WNUVFDWSGQQUIC-CZUVLWSRSA-N |
| XLogP | 5.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|