C33H46O8Si — CID 59466703
[(Z,2S,3R)-6-benzoyloxy-6-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyhex-4-en-2-yl] benzoate (PubChem CID 59466703) has the molecular formula C33H46O8Si and a molecular weight of 598.81 g/mol. Its IUPAC name is [(Z,2S,3R)-6-benzoyloxy-6-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyhex-4-en-2-yl] benzoate.
| Compound Name | [(Z,2S,3R)-6-benzoyloxy-6-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyhex-4-en-2-yl] benzoate |
|---|---|
| PubChem CID | 59466703 |
| Molecular Formula | C33H46O8Si |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | [(Z,2S,3R)-6-benzoyloxy-6-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyhex-4-en-2-yl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)[C@H](O)/C=C\C(OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H46O8Si/c1-23(38-30(35)24-15-11-9-12-16-24)26(34)19-20-27(39-31(36)25-17-13-10-14-18-25)29-28(40-33(5,6)41-29)21-22-37-42(7,8)32(2,3)4/h9-20,23,26-29,34H,21-22H2,1-8H3/b20-19-/t23-,26+,27?,28-,29+/m0/s1 |
| InChIKey | MCITYIJBOFATIJ-IEEVADKBSA-N |
| XLogP | 6.31 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|