C23H38O5 — CID 11315402
(2S)-2-[(4S,5S,6R)-6-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-ol (PubChem CID 11315402) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is (2S)-2-[(4S,5S,6R)-6-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-ol.
| Compound Name | (2S)-2-[(4S,5S,6R)-6-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-ol |
|---|---|
| PubChem CID | 11315402 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (2S)-2-[(4S,5S,6R)-6-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-ol |
| SMILES | CCC(O)[C@H](C)[C@@H]1OC(C)(C)O[C@H]([C@@H](C)COCc2ccc(OC)cc2)[C@@H]1C |
| InChI | InChI=1S/C23H38O5/c1-8-20(24)16(3)22-17(4)21(27-23(5,6)28-22)15(2)13-26-14-18-9-11-19(25-7)12-10-18/h9-12,15-17,20-22,24H,8,13-14H2,1-7H3/t15-,16-,17-,20?,21+,22-/m0/s1 |
| InChIKey | MZIKGVCGYDQPCC-PYMNFCPESA-N |
| XLogP | 4.41 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |