C34H50O7 — CID 102094772
(4R,5S,6S)-6-[(4R,5S,6S)-5-[(4-methoxyphenyl)methoxy]-6-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]-5-methylhept-1-en-4-ol (PubChem CID 102094772) has the molecular formula C34H50O7 and a molecular weight of 570.77 g/mol. Its IUPAC name is (4R,5S,6S)-6-[(4R,5S,6S)-5-[(4-methoxyphenyl)methoxy]-6-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]-5-methylhept-1-en-4-ol.
| Compound Name | (4R,5S,6S)-6-[(4R,5S,6S)-5-[(4-methoxyphenyl)methoxy]-6-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]-5-methylhept-1-en-4-ol |
|---|---|
| PubChem CID | 102094772 |
| Molecular Formula | C34H50O7 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | (4R,5S,6S)-6-[(4R,5S,6S)-5-[(4-methoxyphenyl)methoxy]-6-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]-5-methylhept-1-en-4-ol |
| SMILES | C=CC[C@@H](O)[C@@H](C)[C@H](C)[C@H]1OC(C)(C)O[C@@H]([C@H](C)CCOCc2ccc(OC)cc2)[C@@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C34H50O7/c1-9-10-30(35)24(3)25(4)32-33(39-22-27-13-17-29(37-8)18-14-27)31(40-34(5,6)41-32)23(2)19-20-38-21-26-11-15-28(36-7)16-12-26/h9,11-18,23-25,30-33,35H,1,10,19-22H2,2-8H3/t23-,24+,25+,30-,31+,32-,33+/m1/s1 |
| InChIKey | AJTDPCHEMDCJDP-WIRLCFDISA-N |
| XLogP | 6.56 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|