C25H38O9 — CID 53349248
(1S,4R)-4-(methoxymethoxy)-1-[(4S,5S)-5-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-2-yn-1-ol (PubChem CID 53349248) has the molecular formula C25H38O9 and a molecular weight of 482.57 g/mol. Its IUPAC name is (1S,4R)-4-(methoxymethoxy)-1-[(4S,5S)-5-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-2-yn-1-ol.
| Compound Name | (1S,4R)-4-(methoxymethoxy)-1-[(4S,5S)-5-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-2-yn-1-ol |
|---|---|
| PubChem CID | 53349248 |
| Molecular Formula | C25H38O9 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (1S,4R)-4-(methoxymethoxy)-1-[(4S,5S)-5-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-6-[(4-methoxyphenyl)methoxy]hex-2-yn-1-ol |
| SMILES | COCO[C@@H](C)[C@@H]1OC(C)(C)O[C@H]1[C@@H](O)C#C[C@@H](CCOCc1ccc(OC)cc1)OCOC |
| InChI | InChI=1S/C25H38O9/c1-18(31-16-27-4)23-24(34-25(2,3)33-23)22(26)12-11-21(32-17-28-5)13-14-30-15-19-7-9-20(29-6)10-8-19/h7-10,18,21-24,26H,13-17H2,1-6H3/t18-,21-,22-,23-,24-/m0/s1 |
| InChIKey | HZBTYJDFJKGZOT-NHKCCNDQSA-N |
| XLogP | 2.48 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|