C32H46O7 — CID 10886064
(4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-4-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-6-[(2S,3S)-3-[(2S)-oxiran-2-yl]butan-2-yl]-1,3-dioxane (PubChem CID 10886064) has the molecular formula C32H46O7 and a molecular weight of 542.71 g/mol. Its IUPAC name is (4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-4-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-6-[(2S,3S)-3-[(2S)-oxiran-2-yl]butan-2-yl]-1,3-dioxane.
| Compound Name | (4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-4-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-6-[(2S,3S)-3-[(2S)-oxiran-2-yl]butan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 10886064 |
| Molecular Formula | C32H46O7 |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | (4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-4-[(2R)-4-[(4-methoxyphenyl)methoxy]butan-2-yl]-2,2-dimethyl-6-[(2S,3S)-3-[(2S)-oxiran-2-yl]butan-2-yl]-1,3-dioxane |
| SMILES | COc1ccc(COCC[C@@H](C)[C@@H]2OC(C)(C)O[C@H]([C@@H](C)[C@H](C)[C@H]3CO3)[C@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H46O7/c1-21(16-17-35-18-24-8-12-26(33-6)13-9-24)29-31(37-19-25-10-14-27(34-7)15-11-25)30(39-32(4,5)38-29)23(3)22(2)28-20-36-28/h8-15,21-23,28-31H,16-20H2,1-7H3/t21-,22+,23+,28-,29+,30-,31+/m1/s1 |
| InChIKey | ZMOUVNLWOQIBKO-BFNQHAGGSA-N |
| XLogP | 6.02 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|