C33H40O9 — CID 100990462
(3aR,5R,6S,6aR)-5-[(1R)-1,2-bis[(4-methoxyphenyl)methoxy]ethyl]-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 100990462) has the molecular formula C33H40O9 and a molecular weight of 580.67 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(1R)-1,2-bis[(4-methoxyphenyl)methoxy]ethyl]-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(1R)-1,2-bis[(4-methoxyphenyl)methoxy]ethyl]-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 100990462 |
| Molecular Formula | C33H40O9 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(1R)-1,2-bis[(4-methoxyphenyl)methoxy]ethyl]-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | COc1ccc(COC[C@@H](OCc2ccc(OC)cc2)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H40O9/c1-33(2)41-31-30(39-20-24-10-16-27(36-5)17-11-24)29(40-32(31)42-33)28(38-19-23-8-14-26(35-4)15-9-23)21-37-18-22-6-12-25(34-3)13-7-22/h6-17,28-32H,18-21H2,1-5H3/t28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | CHOQYZJQQIAGDP-HXBJCGEWSA-N |
| XLogP | 5.28 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |